Name | 4-methylvaleryl chloride |
Synonyms | Isocaproyl chloride Isocapronyl chloride Iso-hexanoyl chloride 4-METHYLVALERYL CHLORIDE 4-methylvaleryl chloride G-METHYLVALEROYL CHLORIDE 4-METHYLVALEROYL CHLORIDE 4-methyl-pentanoylchlorid 4-Methypentanoyl chloride 4-methylpentanoyl chloride 4-Methylpentanoic acid chloride |
CAS | 38136-29-7 |
EINECS | 253-801-4 |
InChI | InChI=1/C6H11ClO/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3 |
Molecular Formula | C6H11ClO |
Molar Mass | 134.6 |
Density | 0.986±0.06 g/cm3(Predicted) |
Boling Point | 144°C(lit.) |
Flash Point | 41.1°C |
Vapor Presure | 6.15mmHg at 25°C |
Appearance | clear liquid |
Color | Colorless to Light orange to Yellow |
Refractive Index | 1.4230 to 1.4270 |
UN IDs | UN 2920 8/3/PG II |
Hazard Class | 8/3 |
Packing Group | II |
EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |